For research use only. Not for therapeutic Use.
5-Dodecanoylaminofluorescein-β-D-galactopyranoside(Cat No.:M116345) is a fluorogenic substrate used in molecular biology and microbiology. This compound is often employed to detect the activity of β-galactosidase, an enzyme that cleaves the β-galactoside linkage. Upon hydrolysis by β-galactosidase, it produces a fluorescent product that can be easily detected and quantified, making it a valuable tool in various applications, including gene expression studies and reporter gene assays. The dodecanoylamine group enhances the substrate’s lipophilicity, aiding its penetration into cells and enabling the detection of intracellular β-galactosidase activity.
Catalog Number | M116345 |
CAS Number | 138777-25-0 |
Molecular Formula | C44H55NO16 |
Purity | ≥95% |
Storage | Desiccate at +4C |
IUPAC Name | N-[3-oxo-3',6'-bis[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy]spiro[2-benzofuran-1,9'-xanthene]-5-yl]dodecanamide |
InChI | InChI=1S/C44H55NO16/c1-2-3-4-5-6-7-8-9-10-11-34(48)45-23-12-15-27-26(18-23)41(55)61-44(27)28-16-13-24(56-42-39(53)37(51)35(49)32(21-46)59-42)19-30(28)58-31-20-25(14-17-29(31)44)57-43-40(54)38(52)36(50)33(22-47)60-43/h12-20,32-33,35-40,42-43,46-47,49-54H,2-11,21-22H2,1H3,(H,45,48)/t32-,33-,35+,36+,37+,38+,39-,40-,42-,43-/m1/s1 |
InChIKey | SLIWIQKBDGZFQR-PIVCGYGYSA-N |
SMILES | CCCCCCCCCCCC(=O)NC1=CC2=C(C=C1)C3(C4=C(C=C(C=C4)OC5C(C(C(C(O5)CO)O)O)O)OC6=C3C=CC(=C6)OC7C(C(C(C(O7)CO)O)O)O)OC2=O |