5-epi Emtricitabine-13C,15N2(Cat No.:R060823) is a labeled form of 5-epi emtricitabine, featuring carbon-13 and nitrogen-15 isotopes. This high-purity compound is essential in advanced pharmaceutical research, particularly in studying antiviral agents and their metabolic pathways. Its stable isotope labeling ensures precise and accurate mass spectrometric analysis, facilitating investigations into pharmacokinetics, drug metabolism, and antiviral efficacy. With consistent and reliable performance, 5-epi Emtricitabine-13C,15N2 is ideal for rigorous experimental setups, offering a robust and cost-effective solution for high-precision scientific research and the development of novel antiviral therapies.
Catalog Number | R060823 |
CAS Number | NA |
Synonyms | 4-Amino-5-fluoro-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone-13C,15N2; (2R-trans)-4-Amino-5-fluoro-1-[2-(hydroxymethyl)-1,3-oxathiolan-5-yl]-2(1H)-pyrimidinone-13C,15N2; 1,3-Oxathiolane 2(1H)-Oyrimidinone Deriv.-13C,15N2; α-L |
Molecular Formula | C₇¹³CH₁₀FN¹⁵N₂O₃S |
Purity | 95% |
Storage | -20°C |
IUPAC Name | 4-amino-5-fluoro-1-[(2R,5R)-2-(hydroxymethyl)-1,3-oxathiolan-5-yl](213C,1,3-15N2)pyrimidin-2-one |
InChI | InChI=1S/C8H10FN3O3S/c9-4-1-12(8(14)11-7(4)10)5-3-16-6(2-13)15-5/h1,5-6,13H,2-3H2,(H2,10,11,14)/t5-,6-/m1/s1/i8+1,11+1,12+1 |
InChIKey | XQSPYNMVSIKCOC-FTAPCUFXSA-N |
SMILES | C1[C@@H](O[C@H](S1)CO)[15N]2C=C(C(=[15N][13C]2=O)N)F |