For research use only. Not for therapeutic Use.
5-Fluoro-1H-indole-2-carbaldehyde(Cat No.:L032207)is a fluorinated heterocyclic compound used extensively in pharmaceutical and chemical research. Featuring an indole core with a fluorine atom at the 5-position and a formyl group at the 2-position, this compound is a key intermediate in the synthesis of various bioactive molecules, including potential drugs targeting neurological and oncological conditions. Its unique structure allows for selective chemical modifications, making it valuable in medicinal chemistry for developing new therapeutic agents. Additionally, it is used in the synthesis of complex organic molecules and fine chemicals.
CAS Number | 220943-23-7 |
Molecular Formula | C9H6FNO |
Purity | ≥95% |
IUPAC Name | 5-fluoro-1H-indole-2-carbaldehyde |
InChI | InChI=1S/C9H6FNO/c10-7-1-2-9-6(3-7)4-8(5-12)11-9/h1-5,11H |
InChIKey | SVDHOCZCQXVPOU-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=C1F)C=C(N2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |