For research use only. Not for therapeutic Use.
5-Fluoro-2-formylbenzoic acid(CAT: L036949) is a high-purity aromatic compound featuring a formyl group, a fluorine atom, and a carboxylic acid functional group on a benzene ring. This unique structure makes it a valuable intermediate in pharmaceutical research and organic synthesis, particularly for the development of bioactive molecules, small-molecule inhibitors, and fluorine-containing drug candidates. Its functional versatility allows for targeted modifications, facilitating the synthesis of complex heterocycles and fine chemicals. Known for its chemical stability and reactivity, 5-Fluoro-2-formylbenzoic acid is ideal for precision synthesis in medicinal chemistry and advanced research applications, ensuring reliable and efficient results.
CAS Number | 920481-01-2 |
Molecular Formula | C8H5FO3 |
Purity | ≥95% |
IUPAC Name | 5-fluoro-2-formylbenzoic acid |
InChI | InChI=1S/C8H5FO3/c9-6-2-1-5(4-10)7(3-6)8(11)12/h1-4H,(H,11,12) |
InChIKey | ZRTCSMCEKXQYMJ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)C(=O)O)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |