For research use only. Not for therapeutic Use.
5-Fluoro-2-hydroxy-3-nitropyridine(Cat No.:M112126)is a fluorinated pyridine derivative widely used in pharmaceutical and chemical research. Featuring a fluorine atom at the 5-position, a hydroxyl group at the 2-position, and a nitro group at the 3-position on the pyridine ring, this compound is valuable for developing bioactive molecules, including potential therapeutic agents. Its unique combination of functional groups enhances its reactivity, making it an important intermediate in synthesizing complex organic compounds. 5-Fluoro-2-hydroxy-3-nitropyridine is essential in drug discovery and the exploration of new chemical pathways.
CAS Number | 136888-20-5 |
Molecular Formula | C5H3FN2O3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 5-fluoro-3-nitro-1H-pyridin-2-one |
InChI | InChI=1S/C5H3FN2O3/c6-3-1-4(8(10)11)5(9)7-2-3/h1-2H,(H,7,9) |
InChIKey | BLFUHTOZIOQGBU-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)NC=C1F)[N+](=O)[O-] |