For research use only. Not for therapeutic Use.
5-Fluoro-2-methoxy-3-methylpyridine is a fluorinated pyridine derivative used in pharmaceutical and chemical research. Its structure, featuring a fluorine, methoxy, and methyl substituent on the pyridine ring, offers a stable yet reactive framework valuable in drug discovery and development. This compound is particularly useful as an intermediate in synthesizing bioactive molecules, where its fluorine atom can enhance metabolic stability and binding affinity. It’s employed in medicinal chemistry for crafting compounds aimed at therapeutic applications and advanced material synthesis.
Catalog Number | L043392 |
CAS Number | 884494-89-7 |
Molecular Formula | C7H8FNO |
Purity | ≥95% |
IUPAC Name | 5-fluoro-2-methoxy-3-methylpyridine |
InChI | InChI=1S/C7H8FNO/c1-5-3-6(8)4-9-7(5)10-2/h3-4H,1-2H3 |
InChIKey | WRCHFELOVFKOBX-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1OC)F |