For research use only. Not for therapeutic Use.
5-Fluoro-2-methoxybenzonitrile is a fluorinated aromatic compound characterized by the presence of a fluoro group and a methoxy group on a benzene ring, along with a nitrile functional group. This unique structure enhances its reactivity and makes it a valuable building block in organic synthesis. It is used in the development of pharmaceuticals, agrochemicals, and specialty materials. Researchers are interested in its potential applications in drug discovery and materials science, particularly in designing novel compounds with enhanced biological activity and performance.
| Catalog Number | M034137 |
| CAS Number | 189628-38-4 |
| Molecular Formula | C8H6FNO |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 5-fluoro-2-methoxybenzonitrile |
| InChI | InChI=1S/C8H6FNO/c1-11-8-3-2-7(9)4-6(8)5-10/h2-4H,1H3 |
| InChIKey | XNCVSNKXADJGOG-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C#N |
