For research use only. Not for therapeutic Use.
5-Fluoro-2-nitropyridin-3-ol is a fluorinated pyridine derivative with a nitro and hydroxyl group, commonly used in pharmaceutical and agrochemical research. This compound’s unique structure, featuring both electron-withdrawing fluorine and nitro groups, enhances its reactivity, making it a valuable intermediate for synthesizing bioactive molecules. It is particularly useful in medicinal chemistry for the development of kinase inhibitors and antimicrobial agents. Its stability and versatile functional groups make it ideal for research in drug design and organic synthesis applications.
| Catalog Number | L038213 |
| CAS Number | 847902-56-1 |
| Molecular Formula | C5H3FN2O3 |
| Purity | ≥95% |
| IUPAC Name | 5-fluoro-2-nitropyridin-3-ol |
| InChI | InChI=1S/C5H3FN2O3/c6-3-1-4(9)5(7-2-3)8(10)11/h1-2,9H |
| InChIKey | XCYLKKXQKCXJAE-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1O)[N+](=O)[O-])F |
