5-Fluoro-2-(oxiran-2-yl)pyridine(Cat No.:L007869), with the chemical formula C7H6FNO. It is a compound containing a pyridine ring substituted with a fluorine atom at the 5-position and an oxirane (epoxide) group at the 2-position. Compounds with similar structures are important in organic synthesis, serving as versatile intermediates for the preparation of various pharmaceuticals, agrochemicals, and functionalized organic molecules. The presence of the oxirane group provides reactivity, allowing for the formation of complex organic compounds through diverse chemical transformations. Researchers use such compounds to create novel molecules for medicinal and materials science applications.
Catalog Number | L007869 |
CAS Number | 1548860-89-4 |
Molecular Formula | C7H6FNO |
Purity | ≥95% |
IUPAC Name | 5-fluoro-2-(oxiran-2-yl)pyridine |
InChI | InChI=1S/C7H6FNO/c8-5-1-2-6(9-3-5)7-4-10-7/h1-3,7H,4H2 |
InChIKey | MGMLHJMTXVJMNL-UHFFFAOYSA-N |
SMILES | C1C(O1)C2=NC=C(C=C2)F |