For research use only. Not for therapeutic Use.
5-Fluoro-2-(trifluoromethoxy)benzoic acid(Cat No.:L027725)is a specialized chemical compound widely used in pharmaceutical and chemical research. Featuring a benzoic acid core with a fluorine atom at the 5-position and a trifluoromethoxy group at the 2-position, this compound serves as a crucial intermediate in the synthesis of various bioactive molecules and pharmaceutical agents. Its unique structure allows for versatile chemical modifications, making it valuable in medicinal chemistry for developing new therapeutic candidates. This compound is essential for advancing research in drug discovery and organic synthesis.
CAS Number | 1092460-83-7 |
Molecular Formula | C8H4F4O3 |
Purity | ≥95% |
IUPAC Name | 5-fluoro-2-(trifluoromethoxy)benzoic acid |
InChI | InChI=1S/C8H4F4O3/c9-4-1-2-6(15-8(10,11)12)5(3-4)7(13)14/h1-3H,(H,13,14) |
InChIKey | JRQMLAPRSGFPRF-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1F)C(=O)O)OC(F)(F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |