For research use only. Not for therapeutic Use.
(5-Fluoro-3-methylpyridin-2-yl)methanol is a fluorinated pyridine derivative commonly used in pharmaceutical research and organic synthesis. The compound features a methanol group attached to a 5-fluoro-3-methyl-substituted pyridine ring, making it a versatile intermediate in the development of bioactive molecules. It is particularly useful in the synthesis of therapeutic agents, agrochemicals, and heterocyclic compounds. Its unique structure allows for further chemical modifications, contributing to advancements in medicinal chemistry and the design of novel drugs and biochemical research tools.
CAS Number | 1360953-18-9 |
Synonyms | (5-fluoro-3-Methylpyridin-2-yl)Methanol |
Molecular Formula | C7H8FNO |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (5-fluoro-3-methylpyridin-2-yl)methanol |
InChI | InChI=1S/C7H8FNO/c1-5-2-6(8)3-9-7(5)4-10/h2-3,10H,4H2,1H3 |
InChIKey | DIIQRVUEDFESBX-UHFFFAOYSA-N |
SMILES | CC1=CC(=CN=C1CO)F |