For research use only. Not for therapeutic Use.
5-Fluoro-6-methylpyridine-2-carboxylic acid(Cat No.:L043675)is a high-purity heterocyclic compound used extensively in pharmaceutical and chemical research. This molecule features a fluorine atom and a methyl group attached to a pyridine ring, along with a carboxylic acid functional group. It serves as a versatile intermediate in the synthesis of bioactive compounds, including drug candidates and agrochemicals. The unique substitution pattern of 5-Fluoro-6-methylpyridine-2-carboxylic acid enables specific reactivity, making it ideal for precise synthetic applications in medicinal chemistry and innovative research development.
CAS Number | 1005474-88-3 |
Molecular Formula | C7H6FNO2 |
Purity | ≥95% |
IUPAC Name | 5-fluoro-6-methylpyridine-2-carboxylic acid |
InChI | InChI=1S/C7H6FNO2/c1-4-5(8)2-3-6(9-4)7(10)11/h2-3H,1H3,(H,10,11) |
InChIKey | ZJEGUWBJHQZLDE-UHFFFAOYSA-N |
SMILES | CC1=C(C=CC(=N1)C(=O)O)F |