For research use only. Not for therapeutic Use.
5-Fluoro SDB-005-d7 is a deuterium-labeled derivative of 5-fluoro SDB-005, a chemical compound often used in research related to drug development or as a chemical probe. The “SDB-005” part of the name typically refers to a specific compound or class of compounds with potential biological or pharmacological activities. The deuterium labeling (d7) enhances the compound’s use in mass spectrometry and nuclear magnetic resonance (NMR) spectroscopy, allowing precise tracking of the compound in metabolic studies or drug interaction research. This labeling helps in accurately assessing the compound’s distribution, metabolism, and pharmacokinetics in biological systems.
CAS Number | NA |
Synonyms | Naphthalen-1-yl 1-(5-Fluoropentyl)-1H-indazole-3-carboxylate-d7 |
Molecular Formula | C₂₃H₁₄D₇FN₂O₂ |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (2,3,4,5,6,7,8-heptadeuterionaphthalen-1-yl) 1-(5-fluoropentyl)indazole-3-carboxylate |
InChI | InChI=1S/C23H21FN2O2/c24-15-6-1-7-16-26-20-13-5-4-12-19(20)22(25-26)23(27)28-21-14-8-10-17-9-2-3-11-18(17)21/h2-5,8-14H,1,6-7,15-16H2/i2D,3D,8D,9D,10D,11D,14D |
InChIKey | FNMFGMMHNFDPNT-KQPKBUKZSA-N |
SMILES | [2H]C1=C(C(=C2C(=C1[2H])C(=C(C(=C2OC(=O)C3=NN(C4=CC=CC=C43)CCCCCF)[2H])[2H])[2H])[2H])[2H] |