For research use only. Not for therapeutic Use.
5,6-dihydro-5-Fluorouracil (5-FUH<sub>2</sub>) is formed by the hydrogenation of 5-fluorouracil (5-FU; Item No. <span class=/itemid/>14416</span>) <em>via</em> the enzyme dihydropyrimidine dehydrogenase (DPD). Formulations containing 5-FU are used for the treatment of cancer. However, in patients lacking full DPD activity, severe adverse events, including death, can occur. 5-FUH<sub>2</sub> is less toxic than 5-FU but is not as effective (IC<sub>50</sub>s = 3.3 and 560 µM for 5-FU and 5-FUH<sub>2</sub>, respectively in WiDr human colon cancer cells).
| Catalog Number | R004386 |
| CAS Number | 696-06-0 |
| Synonyms | 5,6-Dihydro-5-fluorouracil; 5-Fluoro-5,6-dihydrouracil; 5-Fluorodihydrouracil; 5-Fluorohydrouracil; 5-DHFU; |
| Molecular Formula | C4H5FN2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 5-fluoro-1,3-diazinane-2,4-dione |
| InChI | InChI=1S/C4H5FN2O2/c5-2-1-6-4(9)7-3(2)8/h2H,1H2,(H2,6,7,8,9) |
| InChIKey | RAIRJKWTBBDDAR-UHFFFAOYSA-N |
| SMILES | C1C(C(=O)NC(=O)N1)F |
