For research use only. Not for therapeutic Use.
5-Fluoroindole(Cat No.:R035890), is a chemical compound with the molecular formula C8H6FN. It features an indole ring structure with a fluorine atom attached. This compound’s structure suggests its potential applications in various chemical contexts, particularly in organic synthesis and medicinal chemistry. Indole derivatives often exhibit diverse biological activities, and the presence of the fluorine atom can influence its reactivity and properties, making it valuable in creating specialized molecules used in pharmaceutical research, agrochemicals, and other fine chemicals. It’s unique ring system and functional group offer opportunities for diverse reactions and transformations.
Catalog Number | R035890 |
CAS Number | 399-52-0 |
Synonyms | 5-Fluoro-1H-indole; 5-fluoroindole; NSC 88613; |
Molecular Formula | C8H6FN |
Purity | ≥95% |
Storage | 2-8°C |
IUPAC Name | 5-fluoro-1H-indole |
InChI | InChI=1S/C8H6FN/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5,10H |
InChIKey | ODFFPRGJZRXNHZ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CN2)C=C1F |