For research use only. Not for therapeutic Use.
5-Fluoropyridine-2,3-dicarboxylic acid(Cat No.:M137730) is a chemical compound with the molecular formula C7H4FNO4. It is a derivative of pyridine, containing a fluorine atom at the 5-position and carboxylic acid groups at the 2- and 3-positions of the pyridine ring. This compound is used as a building block in organic synthesis, particularly in the pharmaceutical industry for the preparation of various biologically active compounds. The presence of the fluorine atom and the carboxylic acid groups makes it a versatile intermediate for the introduction of other functional groups. Its structure and reactivity make it valuable for the synthesis of complex molecules.
CAS Number | 1479-96-5 |
Synonyms | 5-fluoropyridine-2,3-dicarboxylic acid |
Molecular Formula | C7H4FNO4 |
Purity | ≥95% |
Storage | Store at +4C |
IUPAC Name | 5-fluoropyridine-2,3-dicarboxylic acid |
InChI | InChI=1S/C7H4FNO4/c8-3-1-4(6(10)11)5(7(12)13)9-2-3/h1-2H,(H,10,11)(H,12,13) |
InChIKey | PYSLFGOXLSPBSX-UHFFFAOYSA-N |
SMILES | C1=C(C=NC(=C1C(=O)O)C(=O)O)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |