For research use only. Not for therapeutic Use.
5-(Fluorosulfonyl)-2-hydroxybenzoic acid(Cat No.:L007770), is a chemical compound with the molecular formula C₇H₅FO₅S. In this structure, a fluorosulfonyl group (-SO₂F) is attached to the fifth carbon of a benzoic acid ring, and a hydroxy group (-OH) is positioned at the second carbon. This compound is a member of the benzoic acid derivatives class, widely used in organic synthesis, pharmaceuticals, and as intermediates in various chemical reactions. Its potential applications range from the development of new drugs to serving as a key component in the synthesis of complex organic molecules due to the reactivity of both the hydroxy and sulfonyl groups.
CAS Number | 400-96-4 |
Molecular Formula | C7H5FO5S |
Purity | ≥95% |
IUPAC Name | 5-fluorosulfonyl-2-hydroxybenzoic acid |
InChI | InChI=1S/C7H5FO5S/c8-14(12,13)4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,(H,10,11) |
InChIKey | AHWKZWHBSGGMJR-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C=C1S(=O)(=O)F)C(=O)O)O |