For research use only. Not for therapeutic Use.
(5-Fluorothiophen-2-yl)methanol(CAT: L038450) is a high-purity heterocyclic compound featuring a fluorine-substituted thiophene ring with a hydroxymethyl group. This versatile structure makes it a valuable intermediate in pharmaceutical research, agrochemical development, and material science. The fluorine atom enhances the molecule’s metabolic stability and biological activity, while the hydroxymethyl group allows for further derivatization in complex synthetic pathways. (5-Fluorothiophen-2-yl)methanol is ideal for the development of bioactive molecules, small-molecule inhibitors, and advanced materials, offering chemical stability, reactivity, and precision for use in both academic and industrial research applications.
CAS Number | 824983-56-4 |
Molecular Formula | C5H5FOS |
Purity | ≥95% |
IUPAC Name | (5-fluorothiophen-2-yl)methanol |
InChI | InChI=1S/C5H5FOS/c6-5-2-1-4(3-7)8-5/h1-2,7H,3H2 |
InChIKey | ANQLQOQLYYSYQP-UHFFFAOYSA-N |
SMILES | C1=C(SC(=C1)F)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |