5-Fluorouracil-15N2（Cat No.:S000321） is a labeled version of 5-fluorouracil, where two nitrogen atoms are enriched with nitrogen-15 (15N). 5-Fluorouracil is a widely used chemotherapeutic agent that targets rapidly dividing cancer cells by interfering with DNA synthesis. The incorporation of 15N enhances the traceability and stability of 5-fluorouracil, allowing for more precise pharmacokinetic and metabolic studies. This isotopic labeling helps researchers understand the drug’s metabolism and mechanism of action more accurately, leading to better optimization of dosing regimens and improved therapeutic outcomes in cancer treatments, particularly for colorectal, breast, and skin cancers.
| Catalog Number | S000321 |
| CAS Number | 68941-95-7 |
| Molecular Formula | C4H3F15N2O2 |
| Purity | 95% |
| IUPAC Name | 5-fluoro-(1,3-15N2)1H-pyrimidine-2,4-dione |
| InChI | InChI=1S/C4H3FN2O2/c5-2-1-6-4(9)7-3(2)8/h1H,(H2,6,7,8,9)/i6+1,7+1 |
| InChIKey | GHASVSINZRGABV-AKZCFXPHSA-N |
| SMILES | C1=C(C(=O)NC(=O)N1)F |
