For research use only. Not for therapeutic Use.
5-(Furan-2-yl)furan-2-carbaldehyde(Cat No.:L007568), is a chemical compound featuring a furan ring with a furan-2-carbaldehyde functional group at the fifth position. This compound’s unique molecular structure makes it valuable in organic synthesis and research. Scientists utilize it as a key building block for the creation of complex organic molecules. Its aromatic furan rings and aldehyde group offer diverse reactivity, enabling the formation of various derivatives. Researchers leverage its properties in the design and synthesis of specialized compounds, contributing significantly to the development of novel materials, pharmaceuticals, and research chemicals in the scientific community.
CAS Number | 16303-60-9 |
Molecular Formula | C9H6O3 |
Purity | ≥95% |
IUPAC Name | 5-(furan-2-yl)furan-2-carbaldehyde |
InChI | InChI=1S/C9H6O3/c10-6-7-3-4-9(12-7)8-2-1-5-11-8/h1-6H |
InChIKey | FAGYPMBOOVLXAO-UHFFFAOYSA-N |
SMILES | C1=COC(=C1)C2=CC=C(O2)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |