For research use only. Not for therapeutic Use.
5-Heneicosylresorcinol(Cat No.:R066488)is a long-chain alkyl resorcinol derivative with significant antimicrobial and anti-inflammatory properties. This compound, containing a 21-carbon alkyl chain attached to the resorcinol ring, is known for its ability to inhibit microbial growth, particularly against Gram-positive bacteria, and reduce inflammation. Its applications are particularly relevant in dermatological treatments and cosmetic formulations, where it can provide skin protection and enhance product stability. With its potential in various therapeutic areas, 5-Heneicosylresorcinol is a valuable ingredient in research focused on developing new antimicrobial and anti-inflammatory agents.
Catalog Number | R066488 |
CAS Number | 70110-59-7 |
Molecular Formula | C27H48O2 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 5-henicosylbenzene-1,3-diol |
InChI | InChI=1S/C27H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-25-22-26(28)24-27(29)23-25/h22-24,28-29H,2-21H2,1H3 |
InChIKey | BLHLKJLSYHEOGY-UHFFFAOYSA-N |
SMILES | CCCCCCCCCCCCCCCCCCCCCC1=CC(=CC(=C1)O)O |