For research use only. Not for therapeutic Use.
5-Hydroxy-1-methylpyridin-2(1H)-one is a nitrogen-containing heterocyclic compound with applications in pharmaceutical and biochemical research. Its unique structure, featuring a hydroxy group and a methyl-substituted pyridinone ring, makes it a valuable intermediate for synthesizing various biologically active molecules. This compound is frequently explored in studies related to metal chelation and enzyme inhibition due to its structural affinity for binding metals and interacting with proteins. Its stability and purity are essential for research in medicinal chemistry and drug development.
Catalog Number | L038111 |
CAS Number | 29094-75-5 |
Molecular Formula | C6H7NO2 |
Purity | ≥95% |
IUPAC Name | 5-hydroxy-1-methylpyridin-2-one |
InChI | InChI=1S/C6H7NO2/c1-7-4-5(8)2-3-6(7)9/h2-4,8H,1H3 |
InChIKey | JTZUTFHXEWRKJR-UHFFFAOYSA-N |
SMILES | CN1C=C(C=CC1=O)O |