For research use only. Not for therapeutic Use.
5-Hydroxy-1,4-dihydropyrimidin-4-one(Cat No.:M073881), also known as uracil-5-ol or 5-hydroxy uracil, is an organic compound derived from uracil, a common nucleobase found in RNA and DNA. It is structurally characterized by a pyrimidine ring with a hydroxyl group (-OH) attached at the fifth carbon. 5-Hydroxy-1,4-dihydropyrimidin-4-one is a key intermediate in the biosynthesis of various nucleosides and nucleotides and plays a role in metabolic pathways related to nucleotide metabolism and pyrimidine salvage. Additionally, it exhibits pharmacological properties and is studied for potential therapeutic applications in diseases such as cancer and neurodegenerative disorders.
CAS Number | 15837-41-9 |
Molecular Formula | C4H4N2O2 |
Purity | ≥95% |
Storage | Store at -20C |
IUPAC Name | 5-hydroxy-1H-pyrimidin-6-one |
InChI | InChI=1S/C4H4N2O2/c7-3-1-5-2-6-4(3)8/h1-2,7H,(H,5,6,8) |
InChIKey | URCOLWAKIPNTEM-UHFFFAOYSA-N |
SMILES | C1=C(C(=O)NC=N1)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |