For research use only. Not for therapeutic Use.
5-Hydroxy-1H-pyrazole-3-carboxylic acid(Cat No.:L035750)is a heterocyclic compound used in pharmaceutical and chemical research. Featuring a pyrazole ring with a hydroxyl group at the 5-position and a carboxylic acid group at the 3-position, this compound is a valuable intermediate in the synthesis of bioactive molecules, including potential drug candidates. Its structure allows for selective chemical modifications, making it useful in the development of therapeutic agents, particularly in anti-inflammatory and antimicrobial research. Additionally, it is employed in studies involving enzyme inhibitors and complex organic synthesis.
CAS Number | 89603-60-1 |
Molecular Formula | C4H4N2O3 |
Purity | ≥95% |
IUPAC Name | 5-oxo-1,2-dihydropyrazole-3-carboxylic acid |
InChI | InChI=1S/C4H4N2O3/c7-3-1-2(4(8)9)5-6-3/h1H,(H,8,9)(H2,5,6,7) |
InChIKey | FERCTUUKKXAWIL-UHFFFAOYSA-N |
SMILES | C1=C(NNC1=O)C(=O)O |