For research use only. Not for therapeutic Use.
5-Hydroxy-4-methyl-pyridine-2-carbonitrile(Cat No.:L015960)is a heterocyclic compound featuring a hydroxyl group at the 5-position, a methyl group at the 4-position, and a nitrile group at the 2-position on a pyridine ring. This compound is valuable in pharmaceutical research and organic synthesis as an intermediate for developing bioactive molecules, including potential drug candidates. The hydroxyl and nitrile groups allow for diverse chemical modifications, making it useful in creating complex molecular structures. Its high purity and reactivity make it essential for advanced research in medicinal chemistry and chemical synthesis.
CAS Number | 1256792-51-4 |
Molecular Formula | C7H6N2O |
Purity | ≥95% |
IUPAC Name | 5-hydroxy-4-methylpyridine-2-carbonitrile |
InChI | InChI=1S/C7H6N2O/c1-5-2-6(3-8)9-4-7(5)10/h2,4,10H,1H3 |
InChIKey | XGFLGLPWVNDWNZ-UHFFFAOYSA-N |
SMILES | CC1=CC(=NC=C1O)C#N |