For research use only. Not for therapeutic Use.
5-Hydroxy Diclofenac is a key metabolite of the nonsteroidal anti-inflammatory drug (NSAID) Diclofenac, crucial for advanced pharmaceutical research. This compound is essential for studying the pharmacokinetics, metabolism, and therapeutic effects of Diclofenac. Its unique properties enable detailed analysis of metabolic pathways and drug interactions. 5-Hydroxy Diclofenac is highly valued for its purity and stability, making it an indispensable tool in the development of effective pain relief and anti-inflammatory treatments, contributing significantly to the advancement of medical science.
CAS Number | 69002-84-2 |
Synonyms | 2-[(2,6-Dichlorophenyl)amino]-5-hydroxy-benzeneacetic Acid; |
Molecular Formula | C14H11Cl2NO3 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 2-[2-(2,6-dichloroanilino)-5-hydroxyphenyl]acetic acid |
InChI | InChI=1S/C14H11Cl2NO3/c15-10-2-1-3-11(16)14(10)17-12-5-4-9(18)6-8(12)7-13(19)20/h1-6,17-18H,7H2,(H,19,20) |
InChIKey | VNQURRWYKFZKJZ-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)Cl)NC2=C(C=C(C=C2)O)CC(=O)O)Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |