For research use only. Not for therapeutic Use.
5-Hydroxymethyl-2-furaldehyde (Cat No.:R000130) is a versatile organic compound derived from the dehydration of sugars, particularly glucose and fructose. This furan derivative plays a key role in green chemistry as a building block for bio-based materials and fuels. HMF is used in the synthesis of valuable chemicals like 2,5-furandicarboxylic acid (FDCA), a precursor for bioplastics. It is also studied for its antioxidant properties and potential applications in food science. With its renewable origin and diverse applications, HMF is central to advancing sustainable chemical and material development.
Catalog Number | R000130 |
CAS Number | 67-47-0 |
Synonyms | 5-(Hydroxymethyl)-2-furancarboxaldehyde; 2-Formyl-5-hydroxymethylfuran; HMF; 2-Hydroxymethyl-5-furfural; 5-(Hydroxymethyl)-2-furancarbonal; 5-(Hydroxymethyl)furfural; 5-Hydroxymethylfurfurol; 5-Oxymethylfurfurole; Hydroxymethylfurfuraldehyde; NSC 407 |
Molecular Formula | C6H6O3 |
Purity | ≥95% |
Target | Fungal |
Storage | -20°C |
IUPAC Name | 5-(hydroxymethyl)furan-2-carbaldehyde |
InChI | InChI=1S/C6H6O3/c7-3-5-1-2-6(4-8)9-5/h1-3,8H,4H2 |
InChIKey | NOEGNKMFWQHSLB-UHFFFAOYSA-N |
SMILES | C1=C(OC(=C1)C=O)CO |