For research use only. Not for therapeutic Use.
5-Hydroxymethyl-2-furancarboxylic acid (Cat No.:R002979) is a furan derivative with potential applications in materials science and pharmaceuticals. It is produced from renewable biomass and has garnered interest for its biodegradability and potential as a building block for bio-based polymers. HFCA exhibits antioxidant properties and has been investigated for its potential as a therapeutic agent. Additionally, it can be used as a platform chemical for the synthesis of various compounds, highlighting its versatility and potential in green chemistry initiatives.
| Catalog Number | R002979 |
| CAS Number | 6338-41-6 |
| Synonyms | Sumikis’ Acid; 5-(Hydroxymethyl)-2-furoic Acid; NSC 40739; |
| Molecular Formula | C6H6O4 |
| Purity | ≥95% |
| Target | Endogenous Metabolite |
| Storage | -20°C |
| IUPAC Name | 5-(hydroxymethyl)furan-2-carboxylic acid |
| InChI | InChI=1S/C6H6O4/c7-3-4-1-2-5(10-4)6(8)9/h1-2,7H,3H2,(H,8,9) |
| InChIKey | PCSKKIUURRTAEM-UHFFFAOYSA-N |
| SMILES | C1=C(OC(=C1)C(=O)O)CO |
