For research use only. Not for therapeutic Use.
5-(Hydroxymethyl)furfuryl alcohol(CAT: R002956), also known as 5-(hydroxymethyl)-2-furylmethanol, is an organic compound derived from the furan ring, featuring both hydroxymethyl and alcohol functional groups. This structure, with its reactive hydroxyl groups, makes it a valuable intermediate in various chemical syntheses, particularly in the development of polymers, resins, and bio-based materials. It is often used in the production of furan-based polymers and as a precursor in the synthesis of specialty chemicals. Due to its bio-based origin, it is of interest in sustainable chemistry, offering a renewable alternative to petroleum-based compounds. Additionally, 5-(hydroxymethyl)furfuryl alcohol is studied in carbohydrate chemistry and biomass conversion processes, as it can be derived from the breakdown of sugars, making it relevant in green chemistry and renewable energy research.
CAS Number | 1883-75-6 |
Synonyms | 2,5-Furandimethanol; 2,5-Di(hydroxymethyl)furan; 5-(Hydroxymethyl)furfuryl Alcohol; FaRez 6305; NSC 40737; NSC 524614; 2,5-Di(hydroxymethyl)furan; FaRez 6305; NSC 40737; NSC 524614 |
Molecular Formula | C6H8O3 |
Purity | ≥95% |
Target | Disease Research Fields |
Storage | -20°C |
IUPAC Name | [5-(hydroxymethyl)furan-2-yl]methanol |
InChI | InChI=1S/C6H8O3/c7-3-5-1-2-6(4-8)9-5/h1-2,7-8H,3-4H2 |
InChIKey | DSLRVRBSNLHVBH-UHFFFAOYSA-N |
SMILES | C1=C(OC(=C1)CO)CO |