For research use only. Not for therapeutic Use.
5-Hydroxymethyluridine(Cat No.:L022152)is a modified nucleoside derived from uridine, featuring a hydroxymethyl group at the 5-position of the pyrimidine ring. This compound is significant in molecular biology and epigenetic studies, as it is a naturally occurring nucleoside in RNA that plays a role in gene expression regulation and RNA modification processes. Its incorporation into RNA strands can influence RNA structure and function, making it a valuable tool for researchers exploring RNA biology, epigenetics, and the development of therapeutic nucleic acids.
CAS Number | 30414-00-7 |
Molecular Formula | C10H14N2O7 |
Purity | ≥95% |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-(hydroxymethyl)pyrimidine-2,4-dione |
InChI | InChI=1S/C10H14N2O7/c13-2-4-1-12(10(18)11-8(4)17)9-7(16)6(15)5(3-14)19-9/h1,5-7,9,13-16H,2-3H2,(H,11,17,18)/t5-,6-,7-,9-/m1/s1 |
InChIKey | VQAJJNQKTRZJIQ-JXOAFFINSA-N |
SMILES | C1=C(C(=O)NC(=O)N1C2C(C(C(O2)CO)O)O)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |