For research use only. Not for therapeutic Use.
5-hydroxypipecolic acid(Cat No.:M065182), also known as L-pipecolic acid, is a cyclic amino acid found in various organisms, including plants and animals. It plays essential roles in diverse biological processes, such as plant defense mechanisms, osmoprotection, and neurotransmission in the mammalian brain. In plants, 5-hydroxy pipecolic acid acts as a signaling molecule, regulating immune responses against pathogens. In mammals, it serves as a neurotransmitter precursor and is implicated in modulating synaptic activity and neuroprotection.
CAS Number | 13096-31-6 |
Molecular Formula | C6H11NO3 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 5-hydroxypiperidine-2-carboxylic acid |
InChI | InChI=1S/C6H11NO3/c8-4-1-2-5(6(9)10)7-3-4/h4-5,7-8H,1-3H2,(H,9,10) |
InChIKey | RKEYKDXXZCICFZ-UHFFFAOYSA-N |
SMILES | C1CC(NCC1O)C(=O)O |