For research use only. Not for therapeutic Use.
5-Hydroxyxanthotoxin is a natural compound found in various plants, including the genus Heracleum. This compound exhibits phototoxic properties, causing skin inflammation and blistering upon exposure to sunlight. Research suggests its potential in dermatological treatments for conditions such as vitiligo and psoriasis. 5-Hydroxyxanthotoxin’s natural occurrence and phototoxic effects make it valuable in medicinal and cosmetic applications.
| Catalog Number | R072384 |
| CAS Number | 7471-73-0 |
| Molecular Formula | C12H8O5 |
| Purity | ≥95% |
| Target | Plants |
| IUPAC Name | 4-hydroxy-9-methoxyfuro[3,2-g]chromen-7-one |
| InChI | InChI=1S/C12H8O5/c1-15-12-10-7(4-5-16-10)9(14)6-2-3-8(13)17-11(6)12/h2-5,14H,1H3 |
| InChIKey | XPFCGZWOHNGDSP-UHFFFAOYSA-N |
| SMILES | COC1=C2C(=C(C3=C1OC(=O)C=C3)O)C=CO2 |
