For research use only. Not for therapeutic Use.
5-Iodo-1H-pyrrolo[2,3-b]pyridine(Cat No.:L032220)is a heterocyclic compound widely used in pharmaceutical research and organic synthesis. The structure features a pyrrolopyridine core with an iodine atom at the 5-position, offering unique reactivity for various chemical transformations. This compound is particularly valuable as an intermediate in the synthesis of biologically active molecules, including kinase inhibitors and other therapeutic agents. The iodine atom facilitates cross-coupling reactions, making it a versatile building block for creating complex molecular frameworks. It is essential for researchers focused on drug discovery and advanced medicinal chemistry.
Catalog Number | L032220 |
CAS Number | 898746-50-4 |
Molecular Formula | C7H5IN2 |
Purity | ≥95% |
IUPAC Name | 5-iodo-1H-pyrrolo[2,3-b]pyridine |
InChI | InChI=1S/C7H5IN2/c8-6-3-5-1-2-9-7(5)10-4-6/h1-4H,(H,9,10) |
InChIKey | CYMDPTJBUBTWEY-UHFFFAOYSA-N |
SMILES | C1=CNC2=NC=C(C=C21)I |