For research use only. Not for therapeutic Use.
5-Iodo-2-methylthiazole(Cat No.:L007149), is a chemical compound. It features a thiazole ring—a five-membered heterocyclic structure—substituted with a methyl group at the 2nd position and an iodine atom at the 5th position. This compound is significant in organic synthesis, particularly in the creation of pharmaceuticals and agrochemicals. Its unique structure and reactivity make it a valuable building block for the synthesis of diverse organic molecules, enabling advancements in drug discovery, crop protection, and other scientific research fields where specialized organic compounds play a crucial role.
CAS Number | 1412902-50-1 |
Molecular Formula | C4H4INS |
Purity | ≥95% |
IUPAC Name | 5-iodo-2-methyl-1,3-thiazole |
InChI | InChI=1S/C4H4INS/c1-3-6-2-4(5)7-3/h2H,1H3 |
InChIKey | WSPHZZQQZDQEPV-UHFFFAOYSA-N |
SMILES | CC1=NC=C(S1)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |