For research use only. Not for therapeutic Use.
5-Iodo-4-methyl-1,3-thiazol-2-amine(Cat No.:L007661), is a chemical compound featuring a thiazole ring substituted with an iodo group at the 5-position, a methyl group at the 4-position, and an amine group at the 2-position. This specific molecular structure is significant in organic synthesis and medicinal chemistry. Researchers use it as a valuable intermediate in the creation of diverse organic molecules, especially in the development of pharmaceuticals and fine chemicals. Its versatile nature allows for various chemical modifications, making it valuable in the design and synthesis of novel compounds for drug discovery and research purposes, contributing to advancements in medicinal chemistry research.
CAS Number | 3034-58-0 |
Molecular Formula | C4H5IN2S |
Purity | ≥95% |
IUPAC Name | 5-iodo-4-methyl-1,3-thiazol-2-amine |
InChI | InChI=1S/C4H5IN2S/c1-2-3(5)8-4(6)7-2/h1H3,(H2,6,7) |
InChIKey | TUDBFJSDYWCXHY-UHFFFAOYSA-N |
SMILES | CC1=C(SC(=N1)N)I |