For research use only. Not for therapeutic Use.
5-Iodobenzo[b]thiophene(Cat No.:L007496), is a chemical compound with a molecular structure consisting of a benzene ring fused with a thiophene ring and an iodine atom attached to the benzene ring. This compound is valuable in the field of organic synthesis, specifically in the development of pharmaceuticals, agrochemicals, and materials science. Its unique structure and reactivity make it a crucial building block for creating complex organic molecules. Researchers utilize 5-Iodobenzo[b]thiophene as a key intermediate in the synthesis of various biologically active compounds and functional materials, contributing significantly to advancements in medicinal and materials chemistry.
CAS Number | 20532-38-1 |
Molecular Formula | C8H5IS |
Purity | ≥95% |
IUPAC Name | 5-iodo-1-benzothiophene |
InChI | InChI=1S/C8H5IS/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H |
InChIKey | XVLLBRYWAUIDSJ-UHFFFAOYSA-N |
SMILES | C1=CC2=C(C=CS2)C=C1I |