For research use only. Not for therapeutic Use.
5-Iodocytidine (Cat.No:R001324) is a halogenated nucleoside derivative. It has been studied for its potential antiviral and antitumor activities. 5-Iodocytidine has shown inhibitory effects against certain viruses and cancer cells. Research suggests its role in nucleic acid synthesis inhibition, providing insights into its potential therapeutic applications in virology and oncology.
| Catalog Number | R001324 |
| CAS Number | 1147-23-5 |
| Synonyms | 1-ß-D-Ribofuranosyl-5-iodocytosine |
| Molecular Formula | C9H12IN3O5 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
| InChI | InChI=1S/C9H12IN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 |
| InChIKey | LQQGJDJXUSAEMZ-UAKXSSHOSA-N |
| SMILES | C1=C(C(=NC(=O)N1C2C(C(C(O2)CO)O)O)N)I |
