For research use only. Not for therapeutic Use.
5-Iodocytidine(Cat No.:R001324)is a nucleoside analog where the cytosine base is substituted with an iodine atom at the 5′ position. It is used in molecular biology and pharmacological research due to its ability to incorporate into RNA and DNA, potentially disrupting nucleic acid synthesis. As an iodinated analog, 5-iodocytidine is studied for its antiviral and anticancer properties, as the iodine atom can affect the molecule’s stability and interaction with enzymes involved in replication. Research has explored its use in targeting specific enzymes or processes, making it a valuable tool for studying nucleic acid metabolism and cell function.
CAS Number | 1147-23-5 |
Synonyms | 1-ß-D-Ribofuranosyl-5-iodocytosine |
Molecular Formula | C9H12IN3O5 |
Purity | ≥95% |
Target | Nucleoside Antimetabolite/Analog |
Storage | -20°C |
IUPAC Name | 4-amino-1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-iodopyrimidin-2-one |
InChI | InChI=1S/C9H12IN3O5/c10-3-1-13(9(17)12-7(3)11)8-6(16)5(15)4(2-14)18-8/h1,4-6,8,14-16H,2H2,(H2,11,12,17)/t4-,5-,6-,8-/m1/s1 |
InChIKey | LQQGJDJXUSAEMZ-UAKXSSHOSA-N |
SMILES | C1=C(C(=NC(=O)N1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)N)I |