For research use only. Not for therapeutic Use.
5-Isopropoxy-2-methylphenylboronic acid (Cat.No:L003552) is a significant chemical compound in organic synthesis. Its distinctive boronic acid functionality grants it utility as a crucial reagent in Suzuki-Miyaura cross-coupling reactions, enabling the construction of complex molecular structures.
Catalog Number | L003552 |
CAS Number | 1451390-99-0 |
Molecular Formula | C10H15BO3 |
Purity | ≥95% |
IUPAC Name | (2-methyl-5-propan-2-yloxyphenyl)boronic acid |
InChI | InChI=1S/C10H15BO3/c1-7(2)14-9-5-4-8(3)10(6-9)11(12)13/h4-7,12-13H,1-3H3 |
InChIKey | GOZKXGDILPLHDM-UHFFFAOYSA-N |
SMILES | B(C1=C(C=CC(=C1)OC(C)C)C)(O)O |