For research use only. Not for therapeutic Use.
5-Isopropyl-1-methyl-1H-pyrazol-3-amine(CAT: L000545) is a chemically important compound with applications primarily in organic and pharmaceutical chemistry. Its action method involves its role as a key intermediate for the synthesis of various compounds. In pharmaceutical chemistry, it serves as a valuable building block for the development of potential drug candidates and bioactive molecules due to its specific structure.
CAS Number | 1229456-20-5 |
Molecular Formula | C7H13N3 |
Purity | ≥95% |
IUPAC Name | 1-methyl-5-propan-2-ylpyrazol-3-amine |
InChI | InChI=1S/C7H13N3/c1-5(2)6-4-7(8)9-10(6)3/h4-5H,1-3H3,(H2,8,9) |
InChIKey | VWCWVIMCDOHIKZ-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |