For research use only. Not for therapeutic Use.
5-Isopropyl-3-methyl-1H-pyrazole is a heterocyclic compound with applications in pharmaceutical and chemical research. Its pyrazole ring, substituted with isopropyl and methyl groups, offers structural diversity that is beneficial in the synthesis of bioactive molecules, particularly as a core structure in medicinal chemistry. This compound serves as a versatile building block for developing drug candidates, agrochemicals, and specialty chemicals. Its reactive nature supports various modifications, making it a valuable component in creating targeted compounds for research and development.
Catalog Number | L022635 |
CAS Number | 91724-94-6 |
Molecular Formula | C7H12N2 |
Purity | ≥95% |
IUPAC Name | 5-methyl-3-propan-2-yl-1H-pyrazole |
InChI | InChI=1S/C7H12N2/c1-5(2)7-4-6(3)8-9-7/h4-5H,1-3H3,(H,8,9) |
InChIKey | RFAYRFKDGUMREU-UHFFFAOYSA-N |
SMILES | CC1=CC(=NN1)C(C)C |