For research use only. Not for therapeutic Use.
5-Ketofructose(Cat No.:M121143), also known as D-arabino-2-hexulose, is a ketohexose sugar derived from fructose. It is an intermediate in the metabolism of fructose and is formed when fructose is metabolized via the fructose-1-phosphate pathway. 5-Ketofructose can undergo further metabolism to yield various products, including glyceraldehyde and dihydroxyacetone phosphate. This compound plays a role in carbohydrate metabolism and has been studied for its potential as a biomarker for diabetes and metabolic disorders. Additionally, 5-keto-fructose is of interest in the food industry due to its sweetening properties and potential use as a low-calorie sweetener.
CAS Number | 1684-29-3 |
Molecular Formula | C6H10O6 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | (3S,4S)-1,3,4,6-tetrahydroxyhexane-2,5-dione |
InChI | InChI=1S/C6H10O6/c7-1-3(9)5(11)6(12)4(10)2-8/h5-8,11-12H,1-2H2/t5-,6-/m1/s1 |
InChIKey | AWQIYVPBMVSGCL-PHDIDXHHSA-N |
SMILES | C(C(=O)C(C(C(=O)CO)O)O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |