For research use only. Not for therapeutic Use.
5-Maleimidovaleric acid(CAT: R073772) is a chemical compound with a structure that includes a maleimide group and a valeric acid moiety. Its mode of action and pharmacological effects are not extensively documented, suggesting it may serve as a chemical intermediate or a building block in various synthetic processes. Compounds like 5-Maleimidovaleric acid often find utility in organic synthesis for creating more complex molecules for pharmaceuticals, agrochemicals, or other specialized applications.
| Catalog Number | R073772 |
| CAS Number | 57078-99-6 |
| Molecular Formula | C9H11NO4 |
| Purity | ≥95% |
| Target | ADC Linker |
| IUPAC Name | 5-(2,5-dioxopyrrol-1-yl)pentanoic acid |
| InChI | InChI=1S/C9H11NO4/c11-7-4-5-8(12)10(7)6-2-1-3-9(13)14/h4-5H,1-3,6H2,(H,13,14) |
| InChIKey | ACVAAFHNDGTZLL-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCCCC(=O)O |
