For research use only. Not for therapeutic Use.
(5-methoxy-1-methyl-1H-pyrazole-3-yl)methanol(Cat No.:L007605), is a chemical compound featuring a pyrazolylmethyl group substituted with a methoxy group at the 5-position and a methyl group at the 1-position. This specific molecular structure is significant in medicinal chemistry and drug discovery. Researchers explore its potential biological activities, often utilizing it as a building block for the synthesis of diverse organic molecules.
Catalog Number | L007605 |
CAS Number | 180519-10-2 |
Molecular Formula | C6H10N2O2 |
Purity | ≥95% |
IUPAC Name | (5-methoxy-1-methylpyrazol-3-yl)methanol |
InChI | InChI=1S/C6H10N2O2/c1-8-6(10-2)3-5(4-9)7-8/h3,9H,4H2,1-2H3 |
InChIKey | RRXPXFAJZSDSBX-UHFFFAOYSA-N |
SMILES | CN1C(=CC(=N1)CO)OC |