For research use only. Not for therapeutic Use.
(5-Methoxy-2-methylphenyl)methanol(Cat No.:L030898)is an aromatic alcohol compound used in pharmaceutical and chemical research. Featuring a methoxy group at the 5-position and a methyl group at the 2-position of the phenyl ring, this compound is valuable as an intermediate in synthesizing various bioactive molecules. Its structure allows for versatile applications, including the development of pharmaceuticals, agrochemicals, and fine chemicals. (5-Methoxy-2-methylphenyl)methanol is essential for researchers focused on creating novel compounds and advancing synthetic methodologies in medicinal chemistry.
CAS Number | 73502-04-2 |
Molecular Formula | C9H12O2 |
Purity | ≥95% |
IUPAC Name | (5-methoxy-2-methylphenyl)methanol |
InChI | InChI=1S/C9H12O2/c1-7-3-4-9(11-2)5-8(7)6-10/h3-5,10H,6H2,1-2H3 |
InChIKey | XJUWMWGTOQVFMH-UHFFFAOYSA-N |
SMILES | CC1=C(C=C(C=C1)OC)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |