For research use only. Not for therapeutic Use.
5-Methoxy-4-methyl-2,3-dihydro-1H-inden-1-one (CAT: L000182) is a chemical compound used primarily in organic chemistry. Its action mechanism involves its role as an intermediate in various chemical reactions, making it a valuable component for the synthesis of complex organic molecules. In the field of organic chemistry, this compound is used for creating derivatives and specialty chemicals. Its applications can vary depending on the specific reactions and target molecules being synthesized.
CAS Number | 28596-58-9 |
Molecular Formula | C11H12O2 |
Purity | ≥95% |
IUPAC Name | 5-methoxy-4-methyl-2,3-dihydroinden-1-one |
InChI | InChI=1S/C11H12O2/c1-7-8-3-5-10(12)9(8)4-6-11(7)13-2/h4,6H,3,5H2,1-2H3 |
InChIKey | MKVVZHDZJZAYPH-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |