For research use only. Not for therapeutic Use.
5-Methoxycytidine（Cat No.:M007564） is a modified nucleoside that differs from cytidine, a standard component of DNA and RNA, by the addition of a methoxy group (-OCH3) at the 5-position of the cytosine base. This chemical alteration influences the base pairing and biochemical properties of the nucleoside. 5-Methoxycytidine is of interest in epigenetic studies and nucleic acid research because modifications like methoxylation can affect gene expression and cellular mechanisms. This compound is used in molecular biology to explore DNA methylation processes, potentially contributing to our understanding of genetic regulation and epigenetic phenomena.
| Catalog Number | M007564 |
| CAS Number | 37805-90-6 |
| Molecular Formula | C10H15N3O6 |
| Purity | ≥95% |
| Target | Nucleoside Antimetabolite/Analog |
| IUPAC Name | 4-amino-1-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methoxypyrimidin-2-one |
| InChI | InChI=1S/C10H15N3O6/c1-18-4-2-13(10(17)12-8(4)11)9-7(16)6(15)5(3-14)19-9/h2,5-7,9,14-16H,3H2,1H3,(H2,11,12,17) |
| InChIKey | IZFJAICCKKWWNM-UHFFFAOYSA-N |
| SMILES | COC1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)O |
