For research use only. Not for therapeutic Use.
(5-Methoxypyridin-2-yl)methanol(Cat No.:R073377)is a high-purity chemical compound frequently used in pharmaceutical research and organic synthesis. This methoxylated pyridine derivative is a valuable intermediate for the development of bioactive molecules, particularly in the synthesis of complex heterocyclic compounds. Its unique structure allows for versatile applications in medicinal chemistry, aiding in the creation of new drug candidates. (5-Methoxypyridin-2-yl)methanol is essential for research focused on exploring novel therapeutic agents and optimizing synthetic pathways, offering reliable performance in advanced chemical synthesis.
CAS Number | 127978-70-5 |
Molecular Formula | C7H9NO2 |
Purity | ≥95% |
IUPAC Name | (5-methoxypyridin-2-yl)methanol |
InChI | InChI=1S/C7H9NO2/c1-10-7-3-2-6(5-9)8-4-7/h2-4,9H,5H2,1H3 |
InChIKey | YSGIZFIQWAPBLG-UHFFFAOYSA-N |
SMILES | COC1=CN=C(C=C1)CO |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |