For research use only. Not for therapeutic Use.
(5-Methoxypyridin-2-yl)methanamine(Cat No.:L033587)is a valuable compound in organic synthesis and pharmaceutical research. Featuring a methoxy group at the 5-position and an amine group attached to a methylene linker at the 2-position of the pyridine ring, this compound offers unique reactivity for constructing complex molecular architectures. It is particularly useful in the development of biologically active molecules, where the methoxy group can modulate electronic properties, and the amine group can be further functionalized. This compound is essential for researchers focused on drug discovery, medicinal chemistry, and advanced organic synthesis.
CAS Number | 905306-69-6 |
Molecular Formula | C7H10N2O |
Purity | ≥95% |
IUPAC Name | (5-methoxypyridin-2-yl)methanamine |
InChI | InChI=1S/C7H10N2O/c1-10-7-3-2-6(4-8)9-5-7/h2-3,5H,4,8H2,1H3 |
InChIKey | AKYKNKLVGMYOIL-UHFFFAOYSA-N |
SMILES | COC1=CN=C(C=C1)CN |