For research use only. Not for therapeutic Use.
5-Methoxyquinazoline-2,4(1H,3H)-dione is a heterocyclic compound featuring a quinazoline core with a methoxy group at the 5-position and two carbonyl groups at the 2 and 4 positions. This compound is of interest in medicinal chemistry due to its potential biological activities, including antitumor and antimicrobial properties. The methoxy substituent enhances its solubility and reactivity, making it suitable for further chemical modifications. Its unique structure allows for the synthesis of various derivatives, contributing to drug discovery and development.
CAS Number | 61948-86-5 |
Molecular Formula | C9H8N2O3 |
Purity | ≥95% |
IUPAC Name | 5-methoxy-1H-quinazoline-2,4-dione |
InChI | InChI=1S/C9H8N2O3/c1-14-6-4-2-3-5-7(6)8(12)11-9(13)10-5/h2-4H,1H3,(H2,10,11,12,13) |
InChIKey | MRZRYTQAWAFKOC-UHFFFAOYSA-N |
SMILES | COC1=CC=CC2=C1C(=O)NC(=O)N2 |