For research use only. Not for therapeutic Use.
5-Methoxyquinolin-4-amine (CAT: L000254) is an important compound primarily used in pharmaceutical and organic chemistry. It serves as a key intermediate in the synthesis of various organic molecules, particularly in medicinal chemistry. In pharmaceutical research, this compound plays a pivotal role in the development of pharmaceutical agents, influencing their biological activity and targeting specific processes.
CAS Number | 220844-59-7 |
Molecular Formula | C10H10N2O |
Purity | ≥95% |
IUPAC Name | 5-methoxyquinolin-4-amine |
InChI | InChI=1S/C10H10N2O/c1-13-9-4-2-3-8-10(9)7(11)5-6-12-8/h2-6H,1H3,(H2,11,12) |
InChIKey | PJDFSPWLDZBWIX-UHFFFAOYSA-N |